CAS 53874-72-9 appears in our catalog under these names: 2-Amino-3,5-dichlorobenzaldehyde, 95%, 2-Amino-3,5-dichlorobenzaldehyde, 98%, 2-Amino-3,5-dichlorobenzaldehyde 97%, 2-Amino-3,5-dichlorobenzaldehyde, 97%, 97%, 2-Amino-3,5-dichlorobenzaldehyde, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg, 500mg, 2.5g.
2-amino-3,5-dichlorobenzaldehyde (CAS 53874-72-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-amino-3,5-dichlorobenzaldehyde. InChIKey: GTAKYWVLPLTYSK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2-amino-3,5-dichlorobenzaldehyde |
| InChIKey | GTAKYWVLPLTYSK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)N)Cl)Cl |
Computed by PubChem (NCBI)