CAS 26413-58-1 appears in our catalog under these names: 2-Chloro-6-methylpyridine-4-carbonyl chloride, 95%, 2–chloro–6–methylpyridine–4–carbonylchloride, 2-CHLORO-6-METHYLPYRIDINE-4-CARBONYL CHL, 2-Chloro-6-methylpyridine-4-carbonyl chloride. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
2-chloro-6-methylpyridine-4-carbonyl chloride (CAS 26413-58-1) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-chloro-6-methylpyridine-4-carbonyl chloride. InChIKey: YHKLLTUNTUJQSB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2-chloro-6-methylpyridine-4-carbonyl chloride |
| InChIKey | YHKLLTUNTUJQSB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)