Products 26413-58-1

CAS 26413-58-1 appears in our catalog under these names: 2-Chloro-6-methylpyridine-4-carbonyl chloride, 95%, 2–chloro–6–methylpyridine–4–carbonylchloride, 2-CHLORO-6-METHYLPYRIDINE-4-CARBONYL CHL, 2-Chloro-6-methylpyridine-4-carbonyl chloride, 97%(GC),RG. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-6-methylpyridine-4-carbonyl chloride (CAS 26413-58-1) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2-chloro-6-methylpyridine-4-carbonyl chloride. InChIKey: YHKLLTUNTUJQSB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO
Molecular weight190.02 g/mol
IUPAC name2-chloro-6-methylpyridine-4-carbonyl chloride
InChIKeyYHKLLTUNTUJQSB-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=N1)Cl)C(=O)Cl

Computed by PubChem (NCBI)