cas: 1031928-21-8 — see every product listed under this CAS number, including other names
2-Chloro-7,8-dimethyl-3-phenylquinoline, >97%, >97% (CAS 1031928-21-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118Y2N-250mg |
| cas | 1031928-21-8 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1586.00 Pln | |
| Chemat | 1g | 2958.80 Pln | |
| Chemat | 5g | 7677.20 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-7,8-dimethyl-3-phenylquinoline (CAS 1031928-21-8) is a chemical compound with the molecular formula C17H14ClN and a molecular weight of 267.8 g/mol. IUPAC name: 2-chloro-7,8-dimethyl-3-phenylquinoline. InChIKey: KHGMLGVFKKVIGV-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN |
|---|---|
| Molecular weight | 267.8 g/mol |
| IUPAC name | 2-chloro-7,8-dimethyl-3-phenylquinoline |
| InChIKey | KHGMLGVFKKVIGV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=C(C=C2C=C1)C3=CC=CC=C3)Cl)C |
Computed by PubChem (NCBI)