CAS 1404491-66-2 is the registry number for 5-Chloro-2-(3,5-dimethylphenyl)quinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-(3,5-dimethylphenyl)quinoline (CAS 1404491-66-2) is a chemical compound with the molecular formula C17H14ClN and a molecular weight of 267.8 g/mol. IUPAC name: 5-chloro-2-(3,5-dimethylphenyl)quinoline. InChIKey: UPTBVSYIBDKSED-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN |
|---|---|
| Molecular weight | 267.8 g/mol |
| IUPAC name | 5-chloro-2-(3,5-dimethylphenyl)quinoline |
| InChIKey | UPTBVSYIBDKSED-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC3=C(C=C2)C(=CC=C3)Cl)C |
Computed by PubChem (NCBI)