CAS 101602-31-7 is the registry number for 4-Chloro-6,8-dimethyl-2-phenylquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-chloro-6,8-dimethyl-2-phenylquinoline (CAS 101602-31-7) is a chemical compound with the molecular formula C17H14ClN and a molecular weight of 267.8 g/mol. IUPAC name: 4-chloro-6,8-dimethyl-2-phenylquinoline. InChIKey: MCCJMSALUBTGDI-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN |
|---|---|
| Molecular weight | 267.8 g/mol |
| IUPAC name | 4-chloro-6,8-dimethyl-2-phenylquinoline |
| InChIKey | MCCJMSALUBTGDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=CC=C3)Cl)C |
Computed by PubChem (NCBI)