cas: 825630-79-3 — see every product listed under this CAS number, including other names
2-Chloro-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 95%, 95% (CAS 825630-79-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0YX-250mg |
| cas | 825630-79-3 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1149.20 Pln | |
| Chemat | 1g | 2267.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 825630-79-3) is a chemical compound with the molecular formula C14H19BClNO3 and a molecular weight of 295.57 g/mol. IUPAC name: 2-chloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: SDEMCVFPLGEVJY-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO3 |
|---|---|
| Molecular weight | 295.57 g/mol |
| IUPAC name | 2-chloro-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | SDEMCVFPLGEVJY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)CCl |
Computed by PubChem (NCBI)