CAS 1884233-06-0 is the registry number for N-[5-Chloro-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1884233-06-0) is a chemical compound with the molecular formula C14H19BClNO3 and a molecular weight of 295.57 g/mol. IUPAC name: N-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: ZTFIUAJGQDWYBC-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO3 |
|---|---|
| Molecular weight | 295.57 g/mol |
| IUPAC name | N-[5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | ZTFIUAJGQDWYBC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)NC(=O)C |
Computed by PubChem (NCBI)