CAS 957063-08-0 appears in our catalog under these names: 2-Acetamido-5-chlorophenylboronic acid, pinacol ester, 96%, N-(4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 957063-08-0) is a chemical compound with the molecular formula C14H19BClNO3 and a molecular weight of 295.57 g/mol. IUPAC name: N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: MRVKLPGHTKQJIT-UHFFFAOYSA-N.
| Molecular formula | C14H19BClNO3 |
|---|---|
| Molecular weight | 295.57 g/mol |
| IUPAC name | N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | MRVKLPGHTKQJIT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)NC(=O)C |
Computed by PubChem (NCBI)