2-Chloro-N-cyclohexyl-5-methylpyrimidin-4-amine, 98%
cas: 1480295-17-7 — see every product listed under this CAS number, including other names
2-Chloro-N-cyclohexyl-5-methylpyrimidin-4-amine, 98% (CAS 1480295-17-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1880385-10mg |
| cas | 1480295-17-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 381.50 Pln | |
| Ambeed | 25mg | 665.19 Pln | |
| Ambeed | 50mg | 1087.94 Pln | |
| Ambeed | 100mg | 1794.38 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 8441.56 Pln | |
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 25mg | 770.00 Pln | |
| Chemat | 50mg | 1269.20 Pln | |
| Chemat | 100mg | 2114.00 Pln | |
| Chemat | 250mg | 3750.80 Pln | |
| BLDpharm | 10mg | 408.77 Pln | |
| BLDpharm | 25mg | 714.22 Pln | |
| BLDpharm | 50mg | 1164.06 Pln | |
| BLDpharm | 100mg | 1930.46 Pln | |
| BLDpharm | 250mg | 3413.27 Pln | |
| BLDpharm | 1g | 9094.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-chloro-N-cyclohexyl-5-methylpyrimidin-4-amine (CAS 1480295-17-7) is a chemical compound with the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. IUPAC name: 2-chloro-N-cyclohexyl-5-methylpyrimidin-4-amine. InChIKey: QHVQDXBPDKYWDB-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3 |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | 2-chloro-N-cyclohexyl-5-methylpyrimidin-4-amine |
| InChIKey | QHVQDXBPDKYWDB-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N=C1NC2CCCCC2)Cl |
Computed by PubChem (NCBI)