CAS 1185704-16-8 is the registry number for [2-(6,7-Dimethyl-1h-benzimidazol-2-yl)ethyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride (CAS 1185704-16-8) is a chemical compound with the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. IUPAC name: 2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride. InChIKey: QTSQHXFRYOUFIQ-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3 |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | 2-(4,5-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride |
| InChIKey | QTSQHXFRYOUFIQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CCN)C.Cl |
Computed by PubChem (NCBI)