CAS 1185294-80-7 is the registry number for 2-(5,6-Dimethyl-1H-benzo[d]imidazol-2-yl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride (CAS 1185294-80-7) is a chemical compound with the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. IUPAC name: 2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride. InChIKey: HCIMBDDDVOAQAE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3 |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | 2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethanamine;hydrochloride |
| InChIKey | HCIMBDDDVOAQAE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(N2)CCN.Cl |
Computed by PubChem (NCBI)