cas: 488149-34-4 — see every product listed under this CAS number, including other names
2-Chloro-N-methoxy-N-methylnicotinamide, 98% (CAS 488149-34-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A252252-250mg |
| cas | 488149-34-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 317.38 Pln | |
| AmBeed | 1g | 369.46 Pln | |
| Fluorochem | 100mg | 164.54 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-N-methoxy-N-methylpyridine-3-carboxamide (CAS 488149-34-4) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-N-methoxy-N-methylpyridine-3-carboxamide. InChIKey: KGZJITSOJPZKSG-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-N-methoxy-N-methylpyridine-3-carboxamide |
| InChIKey | KGZJITSOJPZKSG-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(N=CC=C1)Cl)OC |
Computed by PubChem (NCBI)