CAS 175276-80-9 appears in our catalog under these names: 2-(2-Chlorophenoxy)acetamide oxime, 95%, 2-(2-Chlorophenoxy)-N'-hydroxyacetimidamide, 95+%, 2-(2-Chlorophenoxy)-N'-hydroxyethanimidamide, 2-(2-Chlorophenoxy)acetamide oxime. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 5g, 0,25g, 2,5g, 25g.
2-(2-chlorophenoxy)-N'-hydroxyethanimidamide (CAS 175276-80-9) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 2-(2-chlorophenoxy)-N'-hydroxyethanimidamide. InChIKey: NDOSJMHHYUKPIM-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-(2-chlorophenoxy)-N'-hydroxyethanimidamide |
| InChIKey | NDOSJMHHYUKPIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)