CAS 17815-99-5 is the registry number for 4-Chloro-n,n-dimethyl-2-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-chloro-N,N-dimethyl-2-nitroaniline (CAS 17815-99-5) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 4-chloro-N,N-dimethyl-2-nitroaniline. InChIKey: QOMAYFFYZHAPEH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 4-chloro-N,N-dimethyl-2-nitroaniline |
| InChIKey | QOMAYFFYZHAPEH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)