2-Chloro-n-cyclohexyl-n-phenylacetamide, 98%
cas: 100721-33-3 — see every product listed under this CAS number, including other names
2-Chloro-n-cyclohexyl-n-phenylacetamide, 98% (CAS 100721-33-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1113QK-50mg |
| cas | 100721-33-3 |
| size | 50mg |
| availability | 2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 500mg | 558.80 Pln | |
| Chemat | 1g | 875.60 Pln | |
| Fluorochem | 100mg | 310.32 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 500mg | 914.28 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 2.5g | 2476.23 Pln | |
| Fluorochem | 5g | 4543.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-N-cyclohexyl-N-phenylacetamide (CAS 100721-33-3) is a chemical compound with the molecular formula C14H18ClNO and a molecular weight of 251.75 g/mol. IUPAC name: 2-chloro-N-cyclohexyl-N-phenylacetamide. InChIKey: WDAVIQBJLVXQGA-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 2-chloro-N-cyclohexyl-N-phenylacetamide |
| InChIKey | WDAVIQBJLVXQGA-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N(C2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)