CAS 915781-03-2 is the registry number for 1-(1-Amino-2-methyl-propyl)naphthalen-2-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-(1-amino-2-methylpropyl)naphthalen-2-ol;hydrochloride (CAS 915781-03-2) is a chemical compound with the molecular formula C14H18ClNO and a molecular weight of 251.75 g/mol. IUPAC name: 1-(1-amino-2-methylpropyl)naphthalen-2-ol;hydrochloride. InChIKey: OOBOYUJDMYNQID-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 1-(1-amino-2-methylpropyl)naphthalen-2-ol;hydrochloride |
| InChIKey | OOBOYUJDMYNQID-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C=CC2=CC=CC=C21)O)N.Cl |
Computed by PubChem (NCBI)