Products 65619-53-6
CAS 65619-53-6 appears in our catalog under these names: 4-(3-Chlorophenyl)-4-(dimethylamino)cyclohexan-1-one, 95%, 4-(3-Chlorophenyl)-4-(dimethylamino)cyclohexan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 50g, 25g, 5g, 10000mg, 5000mg.
4-(3-chlorophenyl)-4-(dimethylamino)cyclohexan-1-one (CAS 65619-53-6) is a chemical compound with the molecular formula C14H18ClNO and a molecular weight of 251.75 g/mol. IUPAC name: 4-(3-chlorophenyl)-4-(dimethylamino)cyclohexan-1-one. InChIKey: RYIXLNLJRGYTQM-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO |
|---|---|
| Molecular weight | 251.75 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-4-(dimethylamino)cyclohexan-1-one |
| InChIKey | RYIXLNLJRGYTQM-UHFFFAOYSA-N |
| SMILES | CN(C)C1(CCC(=O)CC1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)