cas: 3158-91-6 — see every product listed under this CAS number, including other names
2-Chlorodibenz[b,f][1,4]Oxazepin-11(10H)-One, 97%, 97% (CAS 3158-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148OA-100mg |
| cas | 3158-91-6 |
| size | 100mg |
| availability | 109.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 1922.00 Pln | |
| Chemat | 100g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one (CAS 3158-91-6) is a chemical compound with the molecular formula C13H8ClNO2 and a molecular weight of 245.66 g/mol. IUPAC name: 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one. InChIKey: ZAGINEPNYIZLLO-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO2 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 8-chloro-5H-benzo[b][1,4]benzoxazepin-6-one |
| InChIKey | ZAGINEPNYIZLLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)