CAS 85385-33-7 is the registry number for 5-Chloro-2-phenoxyphenyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-2-isocyanato-1-phenoxybenzene (CAS 85385-33-7) is a chemical compound with the molecular formula C13H8ClNO2 and a molecular weight of 245.66 g/mol. IUPAC name: 4-chloro-2-isocyanato-1-phenoxybenzene. InChIKey: SCGXZJTXFUNGAL-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO2 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 4-chloro-2-isocyanato-1-phenoxybenzene |
| InChIKey | SCGXZJTXFUNGAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)N=C=O |
Computed by PubChem (NCBI)