CAS 6939-05-5 is the registry number for 2-Chloro-7-nitro-9H-fluorene. Offered by: TRC. Available pack sizes: 50mg.
2-chloro-7-nitro-9H-fluorene (CAS 6939-05-5) is a chemical compound with the molecular formula C13H8ClNO2 and a molecular weight of 245.66 g/mol. IUPAC name: 2-chloro-7-nitro-9H-fluorene. InChIKey: HJFWZNLUJDRROD-UHFFFAOYSA-N.
| Molecular formula | C13H8ClNO2 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 2-chloro-7-nitro-9H-fluorene |
| InChIKey | HJFWZNLUJDRROD-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])C3=C1C=C(C=C3)Cl |
Computed by PubChem (NCBI)