cas: 97614-43-2 — see every product listed under this CAS number, including other names
2-Deoxy-2-fluoro-1,3,5-tri-O-benzoyl-α-D-arabinofuranose 98% (CAS 97614-43-2) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A134316-1000g |
| cas | 97614-43-2 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4681.31 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 236.88 Pln | |
| Ambeed | 100g | 698.56 Pln | |
| Ambeed | 500g | 2951.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A134316 |
[(2R,3R,4S,5R)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate (CAS 97614-43-2) is a chemical compound with the molecular formula C26H21FO7 and a molecular weight of 464.4 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate. InChIKey: JOAHVPNLVYCSAN-UXGLMHHASA-N.
| Molecular formula | C26H21FO7 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
| InChIKey | JOAHVPNLVYCSAN-UXGLMHHASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H](O2)OC(=O)C3=CC=CC=C3)F)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)