CAS 491594-58-2 is the registry number for Clofarabine Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate (CAS 491594-58-2) is a chemical compound with the molecular formula C26H21FO7 and a molecular weight of 464.4 g/mol. IUPAC name: [(2R,3R,4S,5S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate. InChIKey: JOAHVPNLVYCSAN-SRCYTUNASA-N.
| Molecular formula | C26H21FO7 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | [(2R,3R,4S,5S)-3,5-dibenzoyloxy-4-fluorooxolan-2-yl]methyl benzoate |
| InChIKey | JOAHVPNLVYCSAN-SRCYTUNASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H](O2)OC(=O)C3=CC=CC=C3)F)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)