Products 2924-34-7

CAS 2924-34-7 is the registry number for Clofarabine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-fluorooxolan-2-yl]methyl benzoate (CAS 2924-34-7) is a chemical compound with the molecular formula C26H21FO7 and a molecular weight of 464.4 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-fluorooxolan-2-yl]methyl benzoate. InChIKey: YQWZFUWVRLLLGK-LUKWVAJMSA-N.

Identity
Molecular formulaC26H21FO7
Molecular weight464.4 g/mol
IUPAC name[(2R,3R,4S,5R)-3,4-dibenzoyloxy-5-fluorooxolan-2-yl]methyl benzoate
InChIKeyYQWZFUWVRLLLGK-LUKWVAJMSA-N
SMILESC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H](O2)F)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4

Computed by PubChem (NCBI)