cas: 5284-18-4 — see every product listed under this CAS number, including other names
2-Deoxy-D-xylose, 97.00% (CAS 5284-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM98580C-100mg |
| cas | 5284-18-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2814.27 Pln | |
| Chemat | 250mg | 5385.59 Pln | |
| Chemat | 500mg | 8846.60 Pln | |
| Chemat | 50mg | 1924.15 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.00% |
| category | Chemicals |
(3R,4R)-3,4,5-trihydroxypentanal (CAS 5284-18-4) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (3R,4R)-3,4,5-trihydroxypentanal. InChIKey: ASJSAQIRZKANQN-RFZPGFLSSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (3R,4R)-3,4,5-trihydroxypentanal |
| InChIKey | ASJSAQIRZKANQN-RFZPGFLSSA-N |
| SMILES | C(C=O)[C@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)