cas: 64148-19-2 — see every product listed under this CAS number, including other names
2-Dichloromethylbenzonitrile 95% (CAS 64148-19-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984520-1g |
| cas | 64148-19-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 743.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A984520 |
2-(dichloromethyl)benzonitrile (CAS 64148-19-2) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 2-(dichloromethyl)benzonitrile. InChIKey: WASRSQYJNVCGFU-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 2-(dichloromethyl)benzonitrile |
| InChIKey | WASRSQYJNVCGFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C(Cl)Cl |
Computed by PubChem (NCBI)