CAS 96129-73-6 appears in our catalog under these names: 4,7-Dichloro-1H-indole, 98%, 4,7–Dichloroindole, 4,7-Dichloro-1H-indole, 4,7-Dichloroindole, 98%, 98%, 4,7-DICHLOROINDOLE, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 100mg.
4,7-dichloro-1H-indole (CAS 96129-73-6) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 4,7-dichloro-1H-indole. InChIKey: WYCCABIEVMZKJK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 4,7-dichloro-1H-indole |
| InChIKey | WYCCABIEVMZKJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=CN2)Cl |
Computed by PubChem (NCBI)