CAS 57817-08-0 appears in our catalog under these names: 6,7-Dichloro-1h-indole, 95%, 6,7-Dichloro-1H-indole, 6,7-Dichloro-1H-indole 95%, 6,7-Dichloro-1H-indole, 95%, 95%, 6,7-Dichloro-1H-indole, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg, 10g, 25g.
6,7-dichloro-1H-indole (CAS 57817-08-0) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 6,7-dichloro-1H-indole. InChIKey: UWHWAXCLSNQVAG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole |
| InChIKey | UWHWAXCLSNQVAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)Cl)Cl |
Computed by PubChem (NCBI)