cas: 2350-32-5 — see every product listed under this CAS number, including other names
2-Diethylaminoethyl 4-Butoxybenzoate Hydrochloride, 95%, 95% (CAS 2350-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NFR-100mg |
| cas | 2350-32-5 |
| size | 100mg |
| availability | 0.12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride (CAS 2350-32-5) is a chemical compound with the molecular formula C17H28ClNO3 and a molecular weight of 329.9 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride. InChIKey: GDGCCLGDBQIELP-UHFFFAOYSA-N.
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride |
| InChIKey | GDGCCLGDBQIELP-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)C(=O)OCCN(CC)CC.Cl |
Computed by PubChem (NCBI)