CAS 1998701-20-4 is the registry number for H-D-Tyr(tBu)-OtBu hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
Tert-butyl (2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 1998701-20-4) is a chemical compound with the molecular formula C17H28ClNO3 and a molecular weight of 329.9 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: ZAHGOULTAJWDGV-PFEQFJNWSA-N.
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | ZAHGOULTAJWDGV-PFEQFJNWSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)