CAS 17083-23-7 appears in our catalog under these names: H–Tyr(tBu)–OtBu · HCl, H-L-Tyr(tBu)-OtBu*HCl, (S)-tert-Butyl 2-amino-3-(4-(tert-butoxy)phenyl)propanoate hydrochloride, 97%, 97%, (S)-tert-Butyl 2-amino-3-(4-(tert-butoxy)phenyl)propanoate hydrochloride, 95%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
Tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride (CAS 17083-23-7) is a chemical compound with the molecular formula C17H28ClNO3 and a molecular weight of 329.9 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride. InChIKey: ZAHGOULTAJWDGV-UQKRIMTDSA-N.
| Molecular formula | C17H28ClNO3 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate;hydrochloride |
| InChIKey | ZAHGOULTAJWDGV-UQKRIMTDSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C[C@@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)