cas: 139272-67-6 — see every product listed under this CAS number, including other names
2-Ethoxy-2-oxoethyl 2-(2-((2,6-dichlorophenyl)amino)phenyl)acetate, 97%, 97% (CAS 139272-67-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AMX-100mg |
| cas | 139272-67-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2819.60 Pln | |
| Chemat | 250mg | 3851.60 Pln | |
| Chemat | 500mg | 4542.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 139272-67-6) is a chemical compound with the molecular formula C18H17Cl2NO4 and a molecular weight of 382.2 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: JDOYJDOPEHMRPB-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2NO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | JDOYJDOPEHMRPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)