cas: 139272-67-6 — see every product listed under this CAS number, including other names
Aceclofenac ethyl ester (CAS 139272-67-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 0,05g, 0,025g, 0,1g, 0,5g. Offered by: TargetMol, GLPBio, Biosynth, HPC Standards.
| brand | TargetMol |
|---|---|
| catalog number | T36824-5mg |
| cas | 139272-67-6 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 970.30 Pln | |
| TargetMol | 10mg | 1415.27 Pln | |
| TargetMol | 50mg | 3606.55 Pln | |
| TargetMol | 100mg | 4709.45 Pln | |
| GLPBio | 10mg | 910.63 Pln | |
| GLPBio | 100mg | 2291.38 Pln | |
| GLPBio | 5mg | 728.09 Pln | |
| GLPBio | 50mg | 1828.01 Pln | |
| Biosynth | 0,05g | price on request | |
| Biosynth | 0,025g | price on request | |
| Biosynth | 0,1g | price on request | |
| Biosynth | 0,5g | price on request | |
| Biosynth | 0,25g | price on request | |
| HPC Standards | 1x10mg | price on request |
| purity | No data |
|---|---|
| delivery time | on request |
(2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 139272-67-6) is a chemical compound with the molecular formula C18H17Cl2NO4 and a molecular weight of 382.2 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: JDOYJDOPEHMRPB-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2NO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | JDOYJDOPEHMRPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)