CAS 139272-67-6 appears in our catalog under these names: Aceclofenac ethyl ester, 95%, Aceclofenac Impurity E（EP）, Aceclofenac EP Impurity E, Aceclofenac Impurity 5（Aceclofenac EP Impurity E）, Aceclofenac Ethyl Ester, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 250mg, 1g, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate (CAS 139272-67-6) is a chemical compound with the molecular formula C18H17Cl2NO4 and a molecular weight of 382.2 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate. InChIKey: JDOYJDOPEHMRPB-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2NO4 |
|---|---|
| Molecular weight | 382.2 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl) 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | JDOYJDOPEHMRPB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)