cas: 1352656-54-2 — see every product listed under this CAS number, including other names
2-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 95% (CAS 1352656-54-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A657279-10g |
| cas | 1352656-54-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 15557.29 Pln | |
| AmBeed | 25g | 30536.80 Pln | |
| AmBeed | 5g | 9210.04 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1352656-54-2) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: NSNRZPFLKLHDLV-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 2-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | NSNRZPFLKLHDLV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C=O)CC |
Computed by PubChem (NCBI)