cas: 477860-13-2 — see every product listed under this CAS number, including other names
2-Fluoro-(1,1'-biphenyl)-4-ol, 98% (CAS 477860-13-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A745846-250mg |
| cas | 477860-13-2 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1144.15 Pln | |
| AmBeed | 100mg | 714.49 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-4-phenylphenol (CAS 477860-13-2) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 3-fluoro-4-phenylphenol. InChIKey: ZAYRUOZNLRMSTL-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 3-fluoro-4-phenylphenol |
| InChIKey | ZAYRUOZNLRMSTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)O)F |
Computed by PubChem (NCBI)