2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 95%
cas: 137045-30-8 — see every product listed under this CAS number, including other names
2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 95% (CAS 137045-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A797244-250mg |
| cas | 137045-30-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1026.75 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 1154.00 Pln | |
| Chemat | 5g | 4336.40 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1102.97 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-fluoro-4-phenylbenzoic acid (CAS 137045-30-8) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 3-fluoro-4-phenylbenzoic acid. InChIKey: PFKITESTTSWHMP-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 3-fluoro-4-phenylbenzoic acid |
| InChIKey | PFKITESTTSWHMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluorobiphenyl-4-carboxylic acid, [1,1'-Biphenyl]-4-carboxylic acid, 2-fluoro-, FLURBIPROFEN IMPURITY E [EP IMPURITY], FLURBIPROFEN IMPURITY E (EP IMPURITY), 2-Fluoro-[1,1'-biphenyl]-4-carboxylic acid, 3-fluoro-4-phenylbenzoic acid, FLURBIPROFEN EP IMPURITY E, Flurbiprofen Impurity E, 2-Fluorobiphenyl-4-carboxylic acid 97%, 3-fluoro-4-phenyl-benzoic acid