CAS 1611443-83-4 is the registry number for 2-Fluoro-4'-hydroxy-[1,1'-biphenyl]-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-fluoro-3-(4-hydroxyphenyl)benzaldehyde (CAS 1611443-83-4) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 2-fluoro-3-(4-hydroxyphenyl)benzaldehyde. InChIKey: VKMIWNHJRMHKPK-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 2-fluoro-3-(4-hydroxyphenyl)benzaldehyde |
| InChIKey | VKMIWNHJRMHKPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C2=CC=C(C=C2)O)F)C=O |
Computed by PubChem (NCBI)