CAS 168619-04-3 appears in our catalog under these names: 3'-Fluorobiphenyl-3-carboxylic acid, 96%, 3-(3-Fluorophenyl)benzoic acid, 97%, 3'-Fluoro-(1,1'-biphenyl)-3-carboxylic acid, 96%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g.
3-(3-fluorophenyl)benzoic acid (CAS 168619-04-3) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 3-(3-fluorophenyl)benzoic acid. InChIKey: MZZYPWIFSCZUHN-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 3-(3-fluorophenyl)benzoic acid |
| InChIKey | MZZYPWIFSCZUHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)