cas: 146070-35-1 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)benzonitrile, 98%, 98% (CAS 146070-35-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DNW-1g |
| cas | 146070-35-1 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 285.20 Pln | |
| Chemat | 25g | 506.00 Pln | |
| Chemat | 100g | 1557.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-3-(trifluoromethyl)benzonitrile (CAS 146070-35-1) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzonitrile. InChIKey: NMWOWGXPPBIZNH-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzonitrile |
| InChIKey | NMWOWGXPPBIZNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C#N |
Computed by PubChem (NCBI)