CAS 16264-67-8 appears in our catalog under these names: 4,5,6,7-Tetrafluoroindole, 95%, 4,5,6,7-Tetrafluoro-1H-indole, 98%, 4,5,6,7-Tetrafluoroindole, 4,5,6,7-Tetrafluoro-1H-indole, 98%, 98%. Offered by: Combi-blocks, AmBeed, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4,5,6,7-tetrafluoro-1H-indole (CAS 16264-67-8) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 4,5,6,7-tetrafluoro-1H-indole. InChIKey: DTNBMVQXEVNTLO-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 4,5,6,7-tetrafluoro-1H-indole |
| InChIKey | DTNBMVQXEVNTLO-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)