cas: 146070-35-1 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)benzonitrile, 97% (CAS 146070-35-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F001999-250MG |
| cas | 146070-35-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 10g | 346.77 Pln | |
| Fluorochem | 25g | 763.29 Pln | |
| Fluorochem | 100g | 2299.21 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
2-fluoro-3-(trifluoromethyl)benzonitrile (CAS 146070-35-1) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzonitrile. InChIKey: NMWOWGXPPBIZNH-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzonitrile |
| InChIKey | NMWOWGXPPBIZNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C#N |
Computed by PubChem (NCBI)