cas: 1451391-00-6 — see every product listed under this CAS number, including other names
2-Fluoro-3-isopropoxyphenylboronic acid pinacol ester, 98% (CAS 1451391-00-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627990-250MG |
| cas | 1451391-00-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1664.02 Pln | |
| Fluorochem | 10g | 2877.13 Pln | |
| Fluorochem | 25g | 5938.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1451391-00-6) is a chemical compound with the molecular formula C15H22BFO3 and a molecular weight of 280.14 g/mol. IUPAC name: 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DSIBMZWYVMJDAZ-UHFFFAOYSA-N.
| Molecular formula | C15H22BFO3 |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 2-(2-fluoro-3-propan-2-yloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DSIBMZWYVMJDAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC(C)C)F |
Computed by PubChem (NCBI)