cas: 1073477-74-3 — see every product listed under this CAS number, including other names
2-Fluoro-4-(trifluoromethoxy)phenol, 95% (CAS 1073477-74-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QV-8717-1g |
| cas | 1073477-74-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 3941.50 Pln | |
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1614.80 Pln | |
| Chemat | 1g | 3962.00 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 4246.31 Pln | |
| Fluorochem | 100mg | 1549.47 Pln | |
| Fluorochem | 250mg | 3007.29 Pln | |
| Fluorochem | 1g | 7208.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-fluoro-4-(trifluoromethoxy)phenol (CAS 1073477-74-3) is a chemical compound with the molecular formula C7H4F4O2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethoxy)phenol. InChIKey: PFEFZNARVCCVLN-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethoxy)phenol |
| InChIKey | PFEFZNARVCCVLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)F)O |
Computed by PubChem (NCBI)