CAS 1210702-27-4 is the registry number for 5-Fluoro-2-(trifluoromethoxy)phenol, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-(trifluoromethoxy)phenol (CAS 1210702-27-4) is a chemical compound with the molecular formula C7H4F4O2 and a molecular weight of 196.10 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethoxy)phenol. InChIKey: MCDADXAFWZCUOK-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethoxy)phenol |
| InChIKey | MCDADXAFWZCUOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)O)OC(F)(F)F |
Computed by PubChem (NCBI)