CAS 886498-03-9 is the registry number for 2-Fluoro-5-(trifluoromethoxy)phenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-fluoro-5-(trifluoromethoxy)phenol (CAS 886498-03-9) is a chemical compound with the molecular formula C7H4F4O2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)phenol. InChIKey: MKRRYWGEQVWJCA-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)phenol |
| InChIKey | MKRRYWGEQVWJCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)F |
Computed by PubChem (NCBI)