2-Fluoro-4-hydroxybenzoic acid 98%
cas: 65145-13-3 — see every product listed under this CAS number, including other names
2-Fluoro-4-hydroxybenzoic acid 98% (CAS 65145-13-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202955-1g |
| cas | 65145-13-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 820.94 Pln | |
| Ambeed | 500g | 3791.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A202955 |
2-fluoro-4-hydroxybenzoic acid (CAS 65145-13-3) is a chemical compound with the molecular formula C7H5FO3 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-4-hydroxybenzoic acid. InChIKey: NXWTWYULZRDBSA-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-4-hydroxybenzoic acid |
| InChIKey | NXWTWYULZRDBSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-4-hydroxybenzoic Acid, NXWTWYULZRDBSA-UHFFFAOYSA-, InChI=1/C7H5FO3/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3,9H,(H,10,11), 2-fluoro-4-hydroxy-benzoic Acid, Benzoic acid, 2-fluoro-4-hydroxy-, 2-fluoro-4-hydroxy benzoic acid, 2-Fluoro-4-hydroxybenzoic acid, AldrichCPR, 4-hydroxyfluorobenzoic acid, NXWTWYULZRDBSA-UHFFFAOY, 4-hydroxy-2-fluorobenzoic acid