CAS 91658-92-3 appears in our catalog under these names: 2–Fluoro–3–hydroxybenzoic Acid, 2-Fluoro-3-hydroxybenzoic acid, 97%, 2-Fluoro-3-hydroxybenzoic acid 98%, 2-Fluoro-3-hydroxybenzoic acid, 95%, 2-Fluoro-3-hydroxybenzoic Acid, 96%, 96%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
2-fluoro-3-hydroxybenzoic acid (CAS 91658-92-3) is a chemical compound with the molecular formula C7H5FO3 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-3-hydroxybenzoic acid. InChIKey: VKSRITXZTWTEEW-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-3-hydroxybenzoic acid |
| InChIKey | VKSRITXZTWTEEW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)F)C(=O)O |
Computed by PubChem (NCBI)