Products 341-27-5
CAS 341-27-5 appears in our catalog under these names: 3-Fluoro-2-hydroxybenzoic acid, 97%, 3–Fluorosalicylic Acid, 3-Fluoro-2-hydroxybenzoic acid, 3-Fluorosalicylic Acid, >98.0%(GC)(T), 3-Fluoro-2-hydroxybenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 2g, 500mg, 10g, 50g.
3-fluoro-2-hydroxybenzoic acid (CAS 341-27-5) is a chemical compound with the molecular formula C7H5FO3 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-2-hydroxybenzoic acid. InChIKey: GFHCXVJXSLGRJR-UHFFFAOYSA-N.
| Molecular formula | C7H5FO3 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-2-hydroxybenzoic acid |
| InChIKey | GFHCXVJXSLGRJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoro-2-hydroxybenzoic acid, 3-fluorosalicylic acid, Benzoic acid, 3-fluoro-2-hydroxy-, Salicylic acid, 3-fluoro-, 3-fluoro-2-hydroxy-benzoic acid, 3-Fluoro-2-hydroxybenzoic acid #, 2-Hydroxy-3-fluorobenzoic acid, 2-hydroxy 3-fluorobenzoic acid, 3-fluoro-2-hydroxy benzoic acid, Benzoic acid, 3-fluoro-2-hydroxy- pound>>2-Hydroxy-3-fluo