cas: 18614-46-5 — see every product listed under this CAS number, including other names
2-Fluoro-4-nitropyridine 97% (CAS 18614-46-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A774166-100mg |
| cas | 18614-46-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 726.38 Pln | |
| Ambeed | 5g | 2790.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A774166 |
2-fluoro-4-nitropyridine (CAS 18614-46-5) is a chemical compound with the molecular formula C5H3FN2O2 and a molecular weight of 142.09 g/mol. IUPAC name: 2-fluoro-4-nitropyridine. InChIKey: BOGKTBKWDIUAGK-UHFFFAOYSA-N.
| Molecular formula | C5H3FN2O2 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | 2-fluoro-4-nitropyridine |
| InChIKey | BOGKTBKWDIUAGK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])F |
Computed by PubChem (NCBI)