Products 1806334-01-9

CAS 1806334-01-9 is the registry number for 6-Fluoropyrimidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-fluoropyrimidine-4-carboxylic acid (CAS 1806334-01-9) is a chemical compound with the molecular formula C5H3FN2O2 and a molecular weight of 142.09 g/mol. IUPAC name: 6-fluoropyrimidine-4-carboxylic acid. InChIKey: PYNYTTXYAAUFCI-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3FN2O2
Molecular weight142.09 g/mol
IUPAC name6-fluoropyrimidine-4-carboxylic acid
InChIKeyPYNYTTXYAAUFCI-UHFFFAOYSA-N
SMILESC1=C(N=CN=C1F)C(=O)O

Computed by PubChem (NCBI)